C18H22ClNO4S2 — CID 60560982
(4-chloro-5-methyl-2-propan-2-ylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate (PubChem CID 60560982) has the molecular formula C18H22ClNO4S2 and a molecular weight of 415.96 g/mol. Its IUPAC name is (4-chloro-5-methyl-2-propan-2-ylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate.
| Compound Name | (4-chloro-5-methyl-2-propan-2-ylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate |
|---|---|
| PubChem CID | 60560982 |
| Molecular Formula | C18H22ClNO4S2 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (4-chloro-5-methyl-2-propan-2-ylphenyl) 5-(2-acetamidoethyl)thiophene-2-sulfonate |
| SMILES | CC(=O)NCCc1ccc(S(=O)(=O)Oc2cc(C)c(Cl)cc2C(C)C)s1 |
| InChI | InChI=1S/C18H22ClNO4S2/c1-11(2)15-10-16(19)12(3)9-17(15)24-26(22,23)18-6-5-14(25-18)7-8-20-13(4)21/h5-6,9-11H,7-8H2,1-4H3,(H,20,21) |
| InChIKey | CUENKURNWSOQKB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|