C18H27IN4O3S2 — CID 111274062
3-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111274062) has the molecular formula C18H27IN4O3S2 and a molecular weight of 538.48 g/mol. Its IUPAC name is 3-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 3-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111274062 |
| Molecular Formula | C18H27IN4O3S2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 3-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)s1)N(C)CCOc1ccccc1.I |
| InChI | InChI=1S/C18H26N4O3S2.HI/c1-19-18(22(4)12-13-25-15-8-6-5-7-9-15)20-14-16-10-11-17(26-16)27(23,24)21(2)3;/h5-11H,12-14H2,1-4H3,(H,19,20);1H |
| InChIKey | JGSAJZRAYWVKOE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|