C12H13Cl2NOS — CID 115637013
2-[(4-chlorophenyl)methylsulfanyl]-N-(2-chloroprop-2-enyl)acetamide (PubChem CID 115637013) has the molecular formula C12H13Cl2NOS and a molecular weight of 290.22 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-chloroprop-2-enyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-chloroprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 115637013 |
| Molecular Formula | C12H13Cl2NOS |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-chloroprop-2-enyl)acetamide |
| SMILES | C=C(Cl)CNC(=O)CSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13Cl2NOS/c1-9(13)6-15-12(16)8-17-7-10-2-4-11(14)5-3-10/h2-5H,1,6-8H2,(H,15,16) |
| InChIKey | ZTKPJHTWFCLGID-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |