C12H14ClNO4S2 — CID 64890946
3-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]oxolane-3-carboxylic acid (PubChem CID 64890946) has the molecular formula C12H14ClNO4S2 and a molecular weight of 335.83 g/mol. Its IUPAC name is 3-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64890946 |
| Molecular Formula | C12H14ClNO4S2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 3-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]oxolane-3-carboxylic acid |
| SMILES | O=C(CSCc1ccc(Cl)s1)NC1(C(=O)O)CCOC1 |
| InChI | InChI=1S/C12H14ClNO4S2/c13-9-2-1-8(20-9)5-19-6-10(15)14-12(11(16)17)3-4-18-7-12/h1-2H,3-7H2,(H,14,15)(H,16,17) |
| InChIKey | JDQQBXNURXFELQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |