C9H11ClN2O2S2 — CID 106035235
N-[2-(5-chlorothiophen-2-yl)ethyl]-1-cyanoethanesulfonamide (PubChem CID 106035235) has the molecular formula C9H11ClN2O2S2 and a molecular weight of 278.79 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-1-cyanoethanesulfonamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1-cyanoethanesulfonamide |
|---|---|
| PubChem CID | 106035235 |
| Molecular Formula | C9H11ClN2O2S2 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1-cyanoethanesulfonamide |
| SMILES | CC(C#N)S(=O)(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H11ClN2O2S2/c1-7(6-11)16(13,14)12-5-4-8-2-3-9(10)15-8/h2-3,7,12H,4-5H2,1H3 |
| InChIKey | PCLXZOBBYHTZCP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |