C6H6ClNO5S2 — CID 60661310
2-[(5-chlorothiophen-2-yl)sulfonylamino]oxyacetic acid (PubChem CID 60661310) has the molecular formula C6H6ClNO5S2 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60661310 |
| Molecular Formula | C6H6ClNO5S2 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]oxyacetic acid |
| SMILES | O=C(O)CONS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C6H6ClNO5S2/c7-4-1-2-6(14-4)15(11,12)8-13-3-5(9)10/h1-2,8H,3H2,(H,9,10) |
| InChIKey | MDGYTMVCVODNGN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|