C7H9BrN2O3S2 — CID 79994957
N'-(5-bromo-4-methylthiophen-2-yl)sulfonylacetohydrazide (PubChem CID 79994957) has the molecular formula C7H9BrN2O3S2 and a molecular weight of 313.20 g/mol. Its IUPAC name is N'-(5-bromo-4-methylthiophen-2-yl)sulfonylacetohydrazide.
| Compound Name | N'-(5-bromo-4-methylthiophen-2-yl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 79994957 |
| Molecular Formula | C7H9BrN2O3S2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 311.92 |
| IUPAC Name | N'-(5-bromo-4-methylthiophen-2-yl)sulfonylacetohydrazide |
| SMILES | CC(=O)NNS(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C7H9BrN2O3S2/c1-4-3-6(14-7(4)8)15(12,13)10-9-5(2)11/h3,10H,1-2H3,(H,9,11) |
| InChIKey | QVKVYORTUPULDN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|