C22H27NO5S — CID 7169614
[2-(4-tert-butylphenyl)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 7169614) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7169614 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)OCC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-16-6-12-19(13-7-16)29(26,27)23(5)14-21(25)28-15-20(24)17-8-10-18(11-9-17)22(2,3)4/h6-13H,14-15H2,1-5H3 |
| InChIKey | OXASNZOIBXHZHN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |