C10H15N3O3S — CID 2302661
N-(2-hydrazinyl-2-oxoethyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 2302661) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2302661 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NN)cc1 |
| InChI | InChI=1S/C10H15N3O3S/c1-8-3-5-9(6-4-8)17(15,16)13(2)7-10(14)12-11/h3-6H,7,11H2,1-2H3,(H,12,14) |
| InChIKey | JYLCEIRMCAOKST-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|