C17H15ClFNO5S — CID 8676079
[2-(3-fluorophenyl)-2-oxoethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 8676079) has the molecular formula C17H15ClFNO5S and a molecular weight of 399.83 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8676079 |
| Molecular Formula | C17H15ClFNO5S |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H15ClFNO5S/c1-11(20-26(23,24)15-7-5-13(18)6-8-15)17(22)25-10-16(21)12-3-2-4-14(19)9-12/h2-9,11,20H,10H2,1H3/t11-/m0/s1 |
| InChIKey | HYCAKSRAWBNEEU-NSHDSACASA-N |
| XLogP | 2.57 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |