C9H19NO5S2 — CID 114163451
methyl 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoate (PubChem CID 114163451) has the molecular formula C9H19NO5S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoate.
| Compound Name | methyl 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 114163451 |
| Molecular Formula | C9H19NO5S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methyl 2-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)NCC(C)(O)CSC |
| InChI | InChI=1S/C9H19NO5S2/c1-7(8(11)15-3)17(13,14)10-5-9(2,12)6-16-4/h7,10,12H,5-6H2,1-4H3 |
| InChIKey | AFCNBOPEPLIHPI-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |