C8H16N2O3S2 — CID 106245470
1-cyano-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)ethanesulfonamide (PubChem CID 106245470) has the molecular formula C8H16N2O3S2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-cyano-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)ethanesulfonamide |
|---|---|
| PubChem CID | 106245470 |
| Molecular Formula | C8H16N2O3S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-cyano-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)ethanesulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)C(C)C#N |
| InChI | InChI=1S/C8H16N2O3S2/c1-7(4-9)15(12,13)10-5-8(2,11)6-14-3/h7,10-11H,5-6H2,1-3H3 |
| InChIKey | IITNKEAMWPXTIQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |