C8H15N3O3S — CID 106277324
3-(1-cyanoethylsulfonylamino)-2,2-dimethylpropanamide (PubChem CID 106277324) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is 3-(1-cyanoethylsulfonylamino)-2,2-dimethylpropanamide.
| Compound Name | 3-(1-cyanoethylsulfonylamino)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106277324 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-(1-cyanoethylsulfonylamino)-2,2-dimethylpropanamide |
| SMILES | CC(C#N)S(=O)(=O)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C8H15N3O3S/c1-6(4-9)15(13,14)11-5-8(2,3)7(10)12/h6,11H,5H2,1-3H3,(H2,10,12) |
| InChIKey | YHMCSJPNISOPPC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |