C9H18N2O4S — CID 106252817
1-cyano-N-(2-hydroxy-4-methoxy-2-methylbutyl)ethanesulfonamide (PubChem CID 106252817) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-cyano-N-(2-hydroxy-4-methoxy-2-methylbutyl)ethanesulfonamide.
| Compound Name | 1-cyano-N-(2-hydroxy-4-methoxy-2-methylbutyl)ethanesulfonamide |
|---|---|
| PubChem CID | 106252817 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-cyano-N-(2-hydroxy-4-methoxy-2-methylbutyl)ethanesulfonamide |
| SMILES | COCCC(C)(O)CNS(=O)(=O)C(C)C#N |
| InChI | InChI=1S/C9H18N2O4S/c1-8(6-10)16(13,14)11-7-9(2,12)4-5-15-3/h8,11-12H,4-5,7H2,1-3H3 |
| InChIKey | HJJVUHFMSNNBHS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |