C10H22N2O6S — CID 106252638
3-[(2-hydroxy-4-methoxy-2-methylbutyl)sulfamoyl-methylamino]propanoic acid (PubChem CID 106252638) has the molecular formula C10H22N2O6S and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-[(2-hydroxy-4-methoxy-2-methylbutyl)sulfamoyl-methylamino]propanoic acid.
| Compound Name | 3-[(2-hydroxy-4-methoxy-2-methylbutyl)sulfamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 106252638 |
| Molecular Formula | C10H22N2O6S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[(2-hydroxy-4-methoxy-2-methylbutyl)sulfamoyl-methylamino]propanoic acid |
| SMILES | COCCC(C)(O)CNS(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C10H22N2O6S/c1-10(15,5-7-18-3)8-11-19(16,17)12(2)6-4-9(13)14/h11,15H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | OHKUNPBSYMDHHA-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |