C11H24N2O4S — CID 83142369
3-[methyl(2,3,3-trimethylbutylsulfamoyl)amino]propanoic acid (PubChem CID 83142369) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-[methyl(2,3,3-trimethylbutylsulfamoyl)amino]propanoic acid.
| Compound Name | 3-[methyl(2,3,3-trimethylbutylsulfamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 83142369 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[methyl(2,3,3-trimethylbutylsulfamoyl)amino]propanoic acid |
| SMILES | CC(CNS(=O)(=O)N(C)CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O4S/c1-9(11(2,3)4)8-12-18(16,17)13(5)7-6-10(14)15/h9,12H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | ARXYDTQCARSFDM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |