C7H17N3O6S2 — CID 114174999
3-[methyl-[2-(methylsulfamoyl)ethylsulfamoyl]amino]propanoic acid (PubChem CID 114174999) has the molecular formula C7H17N3O6S2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[methyl-[2-(methylsulfamoyl)ethylsulfamoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-(methylsulfamoyl)ethylsulfamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 114174999 |
| Molecular Formula | C7H17N3O6S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-[methyl-[2-(methylsulfamoyl)ethylsulfamoyl]amino]propanoic acid |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C7H17N3O6S2/c1-8-17(13,14)6-4-9-18(15,16)10(2)5-3-7(11)12/h8-9H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | IKLLMBVYJFGICP-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |