C10H20N2O4S2 — CID 80600839
3-[methyl(thian-2-ylmethylsulfamoyl)amino]propanoic acid (PubChem CID 80600839) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-[methyl(thian-2-ylmethylsulfamoyl)amino]propanoic acid.
| Compound Name | 3-[methyl(thian-2-ylmethylsulfamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 80600839 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[methyl(thian-2-ylmethylsulfamoyl)amino]propanoic acid |
| SMILES | CN(CCC(=O)O)S(=O)(=O)NCC1CCCCS1 |
| InChI | InChI=1S/C10H20N2O4S2/c1-12(6-5-10(13)14)18(15,16)11-8-9-4-2-3-7-17-9/h9,11H,2-8H2,1H3,(H,13,14) |
| InChIKey | YDFIFMBOKROZNX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |