C9H19N3O6S — CID 113405032
3-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfamoyl-methylamino]propanoic acid (PubChem CID 113405032) has the molecular formula C9H19N3O6S and a molecular weight of 297.33 g/mol. Its IUPAC name is 3-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 113405032 |
| Molecular Formula | C9H19N3O6S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfamoyl-methylamino]propanoic acid |
| SMILES | COCCNC(=O)CNS(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C9H19N3O6S/c1-12(5-3-9(14)15)19(16,17)11-7-8(13)10-4-6-18-2/h11H,3-7H2,1-2H3,(H,10,13)(H,14,15) |
| InChIKey | HPSJINPKVWZQCO-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|