C9H22N4O3S — CID 54952091
2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-propylacetamide (PubChem CID 54952091) has the molecular formula C9H22N4O3S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-propylacetamide.
| Compound Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 54952091 |
| Molecular Formula | C9H22N4O3S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNS(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C9H22N4O3S/c1-3-6-11-9(14)8-12-17(15,16)13(2)7-4-5-10/h12H,3-8,10H2,1-2H3,(H,11,14) |
| InChIKey | ZKYNKCUXLCYJDF-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |