C9H22N4O3S — CID 54952297
2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-ethylpropanamide (PubChem CID 54952297) has the molecular formula C9H22N4O3S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 54952297 |
| Molecular Formula | C9H22N4O3S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)NS(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C9H22N4O3S/c1-4-11-9(14)8(2)12-17(15,16)13(3)7-5-6-10/h8,12H,4-7,10H2,1-3H3,(H,11,14) |
| InChIKey | UPGQPEAOTGHWIH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |