C10H24N4O3S — CID 54952205
2-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-N-propylacetamide (PubChem CID 54952205) has the molecular formula C10H24N4O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-N-propylacetamide.
| Compound Name | 2-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 54952205 |
| Molecular Formula | C10H24N4O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[[3-aminopropyl(methyl)sulfamoyl]-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)S(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C10H24N4O3S/c1-4-7-12-10(15)9-14(3)18(16,17)13(2)8-5-6-11/h4-9,11H2,1-3H3,(H,12,15) |
| InChIKey | HQNKHEVTUFKCDH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |