C9H18N2O5S — CID 60952620
3-[methyl-[2-oxo-2-(propylamino)ethyl]sulfamoyl]propanoic acid (PubChem CID 60952620) has the molecular formula C9H18N2O5S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-[methyl-[2-oxo-2-(propylamino)ethyl]sulfamoyl]propanoic acid.
| Compound Name | 3-[methyl-[2-oxo-2-(propylamino)ethyl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60952620 |
| Molecular Formula | C9H18N2O5S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-[methyl-[2-oxo-2-(propylamino)ethyl]sulfamoyl]propanoic acid |
| SMILES | CCCNC(=O)CN(C)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C9H18N2O5S/c1-3-5-10-8(12)7-11(2)17(15,16)6-4-9(13)14/h3-7H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | QPRWGALBUGIKSS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |