C9H19N3O5S — CID 112737995
3-[(1-amino-2-methyl-1-oxobutan-2-yl)sulfamoyl-methylamino]propanoic acid (PubChem CID 112737995) has the molecular formula C9H19N3O5S and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-[(1-amino-2-methyl-1-oxobutan-2-yl)sulfamoyl-methylamino]propanoic acid.
| Compound Name | 3-[(1-amino-2-methyl-1-oxobutan-2-yl)sulfamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 112737995 |
| Molecular Formula | C9H19N3O5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-[(1-amino-2-methyl-1-oxobutan-2-yl)sulfamoyl-methylamino]propanoic acid |
| SMILES | CCC(C)(NS(=O)(=O)N(C)CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C9H19N3O5S/c1-4-9(2,8(10)15)11-18(16,17)12(3)6-5-7(13)14/h11H,4-6H2,1-3H3,(H2,10,15)(H,13,14) |
| InChIKey | HZMKAADVVNGZNI-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |