C12H19FN2O4S — CID 106249724
2-amino-4-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzenesulfonamide (PubChem CID 106249724) has the molecular formula C12H19FN2O4S and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzenesulfonamide.
| Compound Name | 2-amino-4-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106249724 |
| Molecular Formula | C12H19FN2O4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-amino-4-fluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzenesulfonamide |
| SMILES | COCCC(C)(O)CNS(=O)(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C12H19FN2O4S/c1-12(16,5-6-19-2)8-15-20(17,18)11-4-3-9(13)7-10(11)14/h3-4,7,15-16H,5-6,8,14H2,1-2H3 |
| InChIKey | NMASJJSCARFXKH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|