C14H24N2O4S — CID 106249745
2-amino-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4,5-dimethylbenzenesulfonamide (PubChem CID 106249745) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4,5-dimethylbenzenesulfonamide.
| Compound Name | 2-amino-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106249745 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-amino-N-(2-hydroxy-4-methoxy-2-methylbutyl)-4,5-dimethylbenzenesulfonamide |
| SMILES | COCCC(C)(O)CNS(=O)(=O)c1cc(C)c(C)cc1N |
| InChI | InChI=1S/C14H24N2O4S/c1-10-7-12(15)13(8-11(10)2)21(18,19)16-9-14(3,17)5-6-20-4/h7-8,16-17H,5-6,9,15H2,1-4H3 |
| InChIKey | YHDCOOPZRKWYCU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|