C9H22N2O3S2 — CID 103835642
2-hydroxy-2-methyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]-3-methylsulfanylpropane (PubChem CID 103835642) has the molecular formula C9H22N2O3S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]-3-methylsulfanylpropane.
| Compound Name | 2-hydroxy-2-methyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]-3-methylsulfanylpropane |
|---|---|
| PubChem CID | 103835642 |
| Molecular Formula | C9H22N2O3S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-hydroxy-2-methyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]-3-methylsulfanylpropane |
| SMILES | CSCC(C)(O)CNS(=O)(=O)N(C)C(C)C |
| InChI | InChI=1S/C9H22N2O3S2/c1-8(2)11(4)16(13,14)10-6-9(3,12)7-15-5/h8,10,12H,6-7H2,1-5H3 |
| InChIKey | HTCZIRPYHNTWBO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |