C10H22N2O4S2 — CID 106247844
2-amino-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfonylbutanamide (PubChem CID 106247844) has the molecular formula C10H22N2O4S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 106247844 |
| Molecular Formula | C10H22N2O4S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-amino-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfonylbutanamide |
| SMILES | CSCC(C)(O)CNC(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O4S2/c1-10(14,7-17-2)6-12-9(13)8(11)4-5-18(3,15)16/h8,14H,4-7,11H2,1-3H3,(H,12,13) |
| InChIKey | RFVQRKGJUMXTNL-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |