C10H22N2O3S2 — CID 79549856
(2S)-2-amino-N-(2-methyl-2-methylsulfonylpropyl)-4-methylsulfanylbutanamide (PubChem CID 79549856) has the molecular formula C10H22N2O3S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-methyl-2-methylsulfonylpropyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(2-methyl-2-methylsulfonylpropyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 79549856 |
| Molecular Formula | C10H22N2O3S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (2S)-2-amino-N-(2-methyl-2-methylsulfonylpropyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O3S2/c1-10(2,17(4,14)15)7-12-9(13)8(11)5-6-16-3/h8H,5-7,11H2,1-4H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | ZPXVQUNGLQGSNQ-QMMMGPOBSA-N |
| XLogP | 0.01 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |