C12H21NO6S — CID 81164998
2-[1-[[(3-ethoxy-3-oxopropyl)sulfonylamino]methyl]cyclobutyl]acetic acid (PubChem CID 81164998) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[1-[[(3-ethoxy-3-oxopropyl)sulfonylamino]methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[(3-ethoxy-3-oxopropyl)sulfonylamino]methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 81164998 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[1-[[(3-ethoxy-3-oxopropyl)sulfonylamino]methyl]cyclobutyl]acetic acid |
| SMILES | CCOC(=O)CCS(=O)(=O)NCC1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C12H21NO6S/c1-2-19-11(16)4-7-20(17,18)13-9-12(5-3-6-12)8-10(14)15/h13H,2-9H2,1H3,(H,14,15) |
| InChIKey | SRIIPVMLJGAGOK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |