C11H19NO7S — CID 115291944
4-[(3-ethoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid (PubChem CID 115291944) has the molecular formula C11H19NO7S and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-[(3-ethoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid.
| Compound Name | 4-[(3-ethoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291944 |
| Molecular Formula | C11H19NO7S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-[(3-ethoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid |
| SMILES | CCOC(=O)CCS(=O)(=O)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C11H19NO7S/c1-2-19-9(13)3-8-20(16,17)12-11(10(14)15)4-6-18-7-5-11/h12H,2-8H2,1H3,(H,14,15) |
| InChIKey | BCZBRILEKJIBGZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |