C10H17NO7S — CID 115291951
4-[(3-methoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid (PubChem CID 115291951) has the molecular formula C10H17NO7S and a molecular weight of 295.31 g/mol. Its IUPAC name is 4-[(3-methoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid.
| Compound Name | 4-[(3-methoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 115291951 |
| Molecular Formula | C10H17NO7S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-[(3-methoxy-3-oxopropyl)sulfonylamino]oxane-4-carboxylic acid |
| SMILES | COC(=O)CCS(=O)(=O)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C10H17NO7S/c1-17-8(12)2-7-19(15,16)11-10(9(13)14)3-5-18-6-4-10/h11H,2-7H2,1H3,(H,13,14) |
| InChIKey | JWQICWWCMSKLHD-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |