C8H15NO6S2 — CID 81163920
1-(2-methylsulfonylethylsulfonylamino)cyclobutane-1-carboxylic acid (PubChem CID 81163920) has the molecular formula C8H15NO6S2 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylsulfonylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-methylsulfonylethylsulfonylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81163920 |
| Molecular Formula | C8H15NO6S2 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1-(2-methylsulfonylethylsulfonylamino)cyclobutane-1-carboxylic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C8H15NO6S2/c1-16(12,13)5-6-17(14,15)9-8(7(10)11)3-2-4-8/h9H,2-6H2,1H3,(H,10,11) |
| InChIKey | NKPRGOMZXDKQHY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |