C9H15NO6S — CID 61358172
1-[(2-methoxy-2-oxoethyl)sulfonylamino]cyclopentane-1-carboxylic acid (PubChem CID 61358172) has the molecular formula C9H15NO6S and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-[(2-methoxy-2-oxoethyl)sulfonylamino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(2-methoxy-2-oxoethyl)sulfonylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 61358172 |
| Molecular Formula | C9H15NO6S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 1-[(2-methoxy-2-oxoethyl)sulfonylamino]cyclopentane-1-carboxylic acid |
| SMILES | COC(=O)CS(=O)(=O)NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C9H15NO6S/c1-16-7(11)6-17(14,15)10-9(8(12)13)4-2-3-5-9/h10H,2-6H2,1H3,(H,12,13) |
| InChIKey | MJEZFGOKYWTMLF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |