C6H11NO6S2 — CID 82840389
1-(methylsulfonylmethylsulfonylamino)cyclopropane-1-carboxylic acid (PubChem CID 82840389) has the molecular formula C6H11NO6S2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-(methylsulfonylmethylsulfonylamino)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(methylsulfonylmethylsulfonylamino)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 82840389 |
| Molecular Formula | C6H11NO6S2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 1-(methylsulfonylmethylsulfonylamino)cyclopropane-1-carboxylic acid |
| SMILES | CS(=O)(=O)CS(=O)(=O)NC1(C(=O)O)CC1 |
| InChI | InChI=1S/C6H11NO6S2/c1-14(10,11)4-15(12,13)7-6(2-3-6)5(8)9/h7H,2-4H2,1H3,(H,8,9) |
| InChIKey | BFIOAFLDUORLDW-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |