C8H16N2O4S3 — CID 82842928
1-(methylsulfonylmethylsulfonylamino)cyclopentane-1-carbothioamide (PubChem CID 82842928) has the molecular formula C8H16N2O4S3 and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(methylsulfonylmethylsulfonylamino)cyclopentane-1-carbothioamide.
| Compound Name | 1-(methylsulfonylmethylsulfonylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 82842928 |
| Molecular Formula | C8H16N2O4S3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-(methylsulfonylmethylsulfonylamino)cyclopentane-1-carbothioamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NC1(C(N)=S)CCCC1 |
| InChI | InChI=1S/C8H16N2O4S3/c1-16(11,12)6-17(13,14)10-8(7(9)15)4-2-3-5-8/h10H,2-6H2,1H3,(H2,9,15) |
| InChIKey | ATXGUYUSZZGYBJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|