C9H17NO4S — CID 114992122
1-(2-methylsulfonylethylamino)cyclopentane-1-carboxylic acid (PubChem CID 114992122) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 1-(2-methylsulfonylethylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2-methylsulfonylethylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114992122 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-(2-methylsulfonylethylamino)cyclopentane-1-carboxylic acid |
| SMILES | CS(=O)(=O)CCNC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C9H17NO4S/c1-15(13,14)7-6-10-9(8(11)12)4-2-3-5-9/h10H,2-7H2,1H3,(H,11,12) |
| InChIKey | CPCFUEMSPHFUOH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |