C8H12F3NO4S — CID 81164653
2-[1-[(trifluoromethylsulfonylamino)methyl]cyclobutyl]acetic acid (PubChem CID 81164653) has the molecular formula C8H12F3NO4S and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[1-[(trifluoromethylsulfonylamino)methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(trifluoromethylsulfonylamino)methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 81164653 |
| Molecular Formula | C8H12F3NO4S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-[1-[(trifluoromethylsulfonylamino)methyl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(CNS(=O)(=O)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C8H12F3NO4S/c9-8(10,11)17(15,16)12-5-7(2-1-3-7)4-6(13)14/h12H,1-5H2,(H,13,14) |
| InChIKey | HWWLVJNXEWXXKZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |