C12H23NO7S — CID 107039392
(2S)-5-ethoxy-5-oxo-2-(2-propan-2-yloxyethylsulfonylamino)pentanoic acid (PubChem CID 107039392) has the molecular formula C12H23NO7S and a molecular weight of 325.38 g/mol. Its IUPAC name is (2S)-5-ethoxy-5-oxo-2-(2-propan-2-yloxyethylsulfonylamino)pentanoic acid.
| Compound Name | (2S)-5-ethoxy-5-oxo-2-(2-propan-2-yloxyethylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 107039392 |
| Molecular Formula | C12H23NO7S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S)-5-ethoxy-5-oxo-2-(2-propan-2-yloxyethylsulfonylamino)pentanoic acid |
| SMILES | CCOC(=O)CC[C@H](NS(=O)(=O)CCOC(C)C)C(=O)O |
| InChI | InChI=1S/C12H23NO7S/c1-4-19-11(14)6-5-10(12(15)16)13-21(17,18)8-7-20-9(2)3/h9-10,13H,4-8H2,1-3H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | NPPRAGQPCPILPG-JTQLQIEISA-N |
| XLogP | 0.13 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |