C9H16N2O7S — CID 61456673
5-amino-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 61456673) has the molecular formula C9H16N2O7S and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-amino-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61456673 |
| Molecular Formula | C9H16N2O7S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-amino-2-[(2-ethoxy-2-oxoethyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)CS(=O)(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H16N2O7S/c1-2-18-8(13)5-19(16,17)11-6(9(14)15)3-4-7(10)12/h6,11H,2-5H2,1H3,(H2,10,12)(H,14,15) |
| InChIKey | QDXMWDLWMMSYAQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |