C7H12N2O7S — CID 175084988
5-amino-5-oxo-2-[(2-sulfoacetyl)amino]pentanoic acid (PubChem CID 175084988) has the molecular formula C7H12N2O7S and a molecular weight of 268.25 g/mol. Its IUPAC name is 5-amino-5-oxo-2-[(2-sulfoacetyl)amino]pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-[(2-sulfoacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 175084988 |
| Molecular Formula | C7H12N2O7S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 5-amino-5-oxo-2-[(2-sulfoacetyl)amino]pentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12N2O7S/c8-5(10)2-1-4(7(12)13)9-6(11)3-17(14,15)16/h4H,1-3H2,(H2,8,10)(H,9,11)(H,12,13)(H,14,15,16) |
| InChIKey | RLKNHDFCVUERTL-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|