C10H18N2O5 — CID 90239937
(2S)-5-amino-2-[(3-hydroxy-3-methylbutanoyl)amino]-5-oxopentanoic acid (PubChem CID 90239937) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is (2S)-5-amino-2-[(3-hydroxy-3-methylbutanoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(3-hydroxy-3-methylbutanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90239937 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2S)-5-amino-2-[(3-hydroxy-3-methylbutanoyl)amino]-5-oxopentanoic acid |
| SMILES | CC(C)(O)CC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-10(2,17)5-8(14)12-6(9(15)16)3-4-7(11)13/h6,17H,3-5H2,1-2H3,(H2,11,13)(H,12,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | SBRXYJTYFLAVTI-LURJTMIESA-N |
| XLogP | -1.02 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |