C13H25N3O4 — CID 104867283
(2S)-5-amino-2-[(3-amino-5,5-dimethylhexanoyl)amino]-5-oxopentanoic acid (PubChem CID 104867283) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-5-amino-2-[(3-amino-5,5-dimethylhexanoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(3-amino-5,5-dimethylhexanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 104867283 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (2S)-5-amino-2-[(3-amino-5,5-dimethylhexanoyl)amino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)CC(N)CC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H25N3O4/c1-13(2,3)7-8(14)6-11(18)16-9(12(19)20)4-5-10(15)17/h8-9H,4-7,14H2,1-3H3,(H2,15,17)(H,16,18)(H,19,20)/t8?,9-/m0/s1 |
| InChIKey | DMPKIRDYRSLPNG-GKAPJAKFSA-N |
| XLogP | -0.03 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |