C13H24N2O4 — CID 114004733
(2R)-4-amino-4-oxo-2-(3,5,5-trimethylhexanoylamino)butanoic acid (PubChem CID 114004733) has the molecular formula C13H24N2O4 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2R)-4-amino-4-oxo-2-(3,5,5-trimethylhexanoylamino)butanoic acid.
| Compound Name | (2R)-4-amino-4-oxo-2-(3,5,5-trimethylhexanoylamino)butanoic acid |
|---|---|
| PubChem CID | 114004733 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (2R)-4-amino-4-oxo-2-(3,5,5-trimethylhexanoylamino)butanoic acid |
| SMILES | CC(CC(=O)N[C@H](CC(N)=O)C(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-8(7-13(2,3)4)5-11(17)15-9(12(18)19)6-10(14)16/h8-9H,5-7H2,1-4H3,(H2,14,16)(H,15,17)(H,18,19)/t8?,9-/m1/s1 |
| InChIKey | KUZWPPPXBYPUAY-YGPZHTELSA-N |
| XLogP | 0.89 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |