About 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide
3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide (PubChem CID 113496988) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide.
Molecular Properties
| Compound Name | 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide |
| PubChem CID | 113496988 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)NCCCC(N)=O |
| InChI | InChI=1S/C12H25N3O2/c1-12(2,3)8-9(13)7-11(17)15-6-4-5-10(14)16/h9H,4-8,13H2,1-3H3,(H2,14,16)(H,15,17) |
| InChIKey | GPUPSZFBLPAZQR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide?
The IUPAC name of 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide (CID 113496988) is 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide.
What is the SMILES notation for 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide?
The canonical SMILES for 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide is CC(C)(C)CC(N)CC(=O)NCCCC(N)=O.
What is the InChIKey of 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide?
The InChIKey is GPUPSZFBLPAZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-12(2,3)8-9(13)7-11(17)15-6-4-5-10(14)16/h9H,4-8,13H2,1-3H3,(H2,14,16)(H,15,17).
What are the key properties of 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide?
3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide has a molecular weight of 243.35 g/mol, XLogP of 0.52, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(4-amino-4-oxobutyl)-5,5-dimethylhexanamide is sourced from PubChem (CID 113496988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).