C12H26N2O2S — CID 113497132
3-amino-5,5-dimethyl-N-(3-methylsulfinylpropyl)hexanamide (PubChem CID 113497132) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-amino-5,5-dimethyl-N-(3-methylsulfinylpropyl)hexanamide.
| Compound Name | 3-amino-5,5-dimethyl-N-(3-methylsulfinylpropyl)hexanamide |
|---|---|
| PubChem CID | 113497132 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-amino-5,5-dimethyl-N-(3-methylsulfinylpropyl)hexanamide |
| SMILES | CS(=O)CCCNC(=O)CC(N)CC(C)(C)C |
| InChI | InChI=1S/C12H26N2O2S/c1-12(2,3)9-10(13)8-11(15)14-6-5-7-17(4)16/h10H,5-9,13H2,1-4H3,(H,14,15) |
| InChIKey | WTWQOBSTSGNYDI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|