C13H26N2O3 — CID 113497097
4-[(3-amino-5,5-dimethylhexanoyl)amino]-3-methylbutanoic acid (PubChem CID 113497097) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-[(3-amino-5,5-dimethylhexanoyl)amino]-3-methylbutanoic acid.
| Compound Name | 4-[(3-amino-5,5-dimethylhexanoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 113497097 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 4-[(3-amino-5,5-dimethylhexanoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(CNC(=O)CC(N)CC(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C13H26N2O3/c1-9(5-12(17)18)8-15-11(16)6-10(14)7-13(2,3)4/h9-10H,5-8,14H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | OLKFTGRDQAKUTE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |