C8H15NO7S — CID 107835309
(2S)-4-[(2-ethoxy-2-oxoethyl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 107835309) has the molecular formula C8H15NO7S and a molecular weight of 269.27 g/mol. Its IUPAC name is (2S)-4-[(2-ethoxy-2-oxoethyl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(2-ethoxy-2-oxoethyl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107835309 |
| Molecular Formula | C8H15NO7S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (2S)-4-[(2-ethoxy-2-oxoethyl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | CCOC(=O)CS(=O)(=O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C8H15NO7S/c1-2-16-7(11)5-17(14,15)9-4-3-6(10)8(12)13/h6,9-10H,2-5H2,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | JWNMENOHIBCXCP-LURJTMIESA-N |
| XLogP | -1.70 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |