C7H14F2N2O4S — CID 114383986
ethyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate (PubChem CID 114383986) has the molecular formula C7H14F2N2O4S and a molecular weight of 260.26 g/mol. Its IUPAC name is ethyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate.
| Compound Name | ethyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 114383986 |
| Molecular Formula | C7H14F2N2O4S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | ethyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C7H14F2N2O4S/c1-2-15-6(12)3-16(13,14)11-5-7(8,9)4-10/h11H,2-5,10H2,1H3 |
| InChIKey | QYPUUQURWGPRAV-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |