C9H18N2O4S — CID 65189082
ethyl 2-[(2-amino-1-cyclopropylethyl)sulfamoyl]acetate (PubChem CID 65189082) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl 2-[(2-amino-1-cyclopropylethyl)sulfamoyl]acetate.
| Compound Name | ethyl 2-[(2-amino-1-cyclopropylethyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 65189082 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 2-[(2-amino-1-cyclopropylethyl)sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)NC(CN)C1CC1 |
| InChI | InChI=1S/C9H18N2O4S/c1-2-15-9(12)6-16(13,14)11-8(5-10)7-3-4-7/h7-8,11H,2-6,10H2,1H3 |
| InChIKey | OJGJHUSUHRVURG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |